C22H15F4IOS — CID 172603682
2-[4-[4-(cyclopenten-1-ylmethoxy)-2,3-difluorophenyl]-2,3-difluorophenyl]-5-iodothiophene (PubChem CID 172603682) has the molecular formula C22H15F4IOS and a molecular weight of 530.32 g/mol. Its IUPAC name is 2-[4-[4-(cyclopenten-1-ylmethoxy)-2,3-difluorophenyl]-2,3-difluorophenyl]-5-iodothiophene.
| Compound Name | 2-[4-[4-(cyclopenten-1-ylmethoxy)-2,3-difluorophenyl]-2,3-difluorophenyl]-5-iodothiophene |
|---|---|
| PubChem CID | 172603682 |
| Molecular Formula | C22H15F4IOS |
| Molecular Weight | 530.32 g/mol |
| Exact Mass | 529.98 |
| IUPAC Name | 2-[4-[4-(cyclopenten-1-ylmethoxy)-2,3-difluorophenyl]-2,3-difluorophenyl]-5-iodothiophene |
| SMILES | Fc1c(OCC2=CCCC2)ccc(-c2ccc(-c3ccc(I)s3)c(F)c2F)c1F |
| InChI | InChI=1S/C22H15F4IOS/c23-19-13(5-6-15(21(19)25)17-9-10-18(27)29-17)14-7-8-16(22(26)20(14)24)28-11-12-3-1-2-4-12/h3,5-10H,1-2,4,11H2 |
| InChIKey | IIHRYFBXBMAMEJ-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.32 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|