C18H13F2IOS — CID 174243856
3-(cyclopenten-1-ylmethoxy)-4,6-difluoro-7-iododibenzothiophene (PubChem CID 174243856) has the molecular formula C18H13F2IOS and a molecular weight of 442.27 g/mol. Its IUPAC name is 3-(cyclopenten-1-ylmethoxy)-4,6-difluoro-7-iododibenzothiophene.
| Compound Name | 3-(cyclopenten-1-ylmethoxy)-4,6-difluoro-7-iododibenzothiophene |
|---|---|
| PubChem CID | 174243856 |
| Molecular Formula | C18H13F2IOS |
| Molecular Weight | 442.27 g/mol |
| Exact Mass | 441.97 |
| IUPAC Name | 3-(cyclopenten-1-ylmethoxy)-4,6-difluoro-7-iododibenzothiophene |
| SMILES | Fc1c(I)ccc2c1sc1c(F)c(OCC3=CCCC3)ccc12 |
| InChI | InChI=1S/C18H13F2IOS/c19-15-13(21)7-5-11-12-6-8-14(16(20)18(12)23-17(11)15)22-9-10-3-1-2-4-10/h3,5-8H,1-2,4,9H2 |
| InChIKey | XIOACEALEBJXRB-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.27 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|