C19H14F4O2S — CID 170268610
3-cyclopentyloxy-7-(2,2-difluoroethenoxy)-4,6-difluorodibenzothiophene (PubChem CID 170268610) has the molecular formula C19H14F4O2S and a molecular weight of 382.38 g/mol. Its IUPAC name is 3-cyclopentyloxy-7-(2,2-difluoroethenoxy)-4,6-difluorodibenzothiophene.
| Compound Name | 3-cyclopentyloxy-7-(2,2-difluoroethenoxy)-4,6-difluorodibenzothiophene |
|---|---|
| PubChem CID | 170268610 |
| Molecular Formula | C19H14F4O2S |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 3-cyclopentyloxy-7-(2,2-difluoroethenoxy)-4,6-difluorodibenzothiophene |
| SMILES | FC(F)=COc1ccc2c(sc3c(F)c(OC4CCCC4)ccc32)c1F |
| InChI | InChI=1S/C19H14F4O2S/c20-15(21)9-24-13-7-5-11-12-6-8-14(25-10-3-1-2-4-10)17(23)19(12)26-18(11)16(13)22/h5-10H,1-4H2 |
| InChIKey | IDLOIJSDXZUFJI-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|