C19H14F4O3 — CID 170268630
3-(cyclobutylmethoxy)-7-(2,2-difluoroethenoxy)-4,6-difluorodibenzofuran (PubChem CID 170268630) has the molecular formula C19H14F4O3 and a molecular weight of 366.31 g/mol. Its IUPAC name is 3-(cyclobutylmethoxy)-7-(2,2-difluoroethenoxy)-4,6-difluorodibenzofuran.
| Compound Name | 3-(cyclobutylmethoxy)-7-(2,2-difluoroethenoxy)-4,6-difluorodibenzofuran |
|---|---|
| PubChem CID | 170268630 |
| Molecular Formula | C19H14F4O3 |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 3-(cyclobutylmethoxy)-7-(2,2-difluoroethenoxy)-4,6-difluorodibenzofuran |
| SMILES | FC(F)=COc1ccc2c(oc3c(F)c(OCC4CCC4)ccc32)c1F |
| InChI | InChI=1S/C19H14F4O3/c20-15(21)9-25-14-7-5-12-11-4-6-13(24-8-10-2-1-3-10)16(22)18(11)26-19(12)17(14)23/h4-7,9-10H,1-3,8H2 |
| InChIKey | SYDAATPDEBCXHZ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|