C17H23FO — CID 159362003
1-(cyclopentylmethoxy)-4-(cyclopropylmethyl)-2-fluoro-3-methylbenzene (PubChem CID 159362003) has the molecular formula C17H23FO and a molecular weight of 262.37 g/mol. Its IUPAC name is 1-(cyclopentylmethoxy)-4-(cyclopropylmethyl)-2-fluoro-3-methylbenzene.
| Compound Name | 1-(cyclopentylmethoxy)-4-(cyclopropylmethyl)-2-fluoro-3-methylbenzene |
|---|---|
| PubChem CID | 159362003 |
| Molecular Formula | C17H23FO |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-(cyclopentylmethoxy)-4-(cyclopropylmethyl)-2-fluoro-3-methylbenzene |
| SMILES | Cc1c(CC2CC2)ccc(OCC2CCCC2)c1F |
| InChI | InChI=1S/C17H23FO/c1-12-15(10-13-6-7-13)8-9-16(17(12)18)19-11-14-4-2-3-5-14/h8-9,13-14H,2-7,10-11H2,1H3 |
| InChIKey | ULMIQIWSEGRXJF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |