C20H27FO — CID 157197964
1-(cyclobutylmethoxy)-4-[(E)-3-cyclopentylprop-2-enyl]-2-fluoro-3-methylbenzene (PubChem CID 157197964) has the molecular formula C20H27FO and a molecular weight of 302.43 g/mol. Its IUPAC name is 1-(cyclobutylmethoxy)-4-[(E)-3-cyclopentylprop-2-enyl]-2-fluoro-3-methylbenzene.
| Compound Name | 1-(cyclobutylmethoxy)-4-[(E)-3-cyclopentylprop-2-enyl]-2-fluoro-3-methylbenzene |
|---|---|
| PubChem CID | 157197964 |
| Molecular Formula | C20H27FO |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 1-(cyclobutylmethoxy)-4-[(E)-3-cyclopentylprop-2-enyl]-2-fluoro-3-methylbenzene |
| SMILES | Cc1c(C/C=C/C2CCCC2)ccc(OCC2CCC2)c1F |
| InChI | InChI=1S/C20H27FO/c1-15-18(11-5-8-16-6-2-3-7-16)12-13-19(20(15)21)22-14-17-9-4-10-17/h5,8,12-13,16-17H,2-4,6-7,9-11,14H2,1H3/b8-5+ |
| InChIKey | SLWFWDJZZQIAMH-VMPITWQZSA-N |
| XLogP | 5.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|