C19H23F3O2 — CID 157180852
1-[(E)-3-cyclobutylprop-2-enyl]-4-(cyclopropylmethoxy)-2-methyl-3-(trifluoromethoxy)benzene (PubChem CID 157180852) has the molecular formula C19H23F3O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is 1-[(E)-3-cyclobutylprop-2-enyl]-4-(cyclopropylmethoxy)-2-methyl-3-(trifluoromethoxy)benzene.
| Compound Name | 1-[(E)-3-cyclobutylprop-2-enyl]-4-(cyclopropylmethoxy)-2-methyl-3-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 157180852 |
| Molecular Formula | C19H23F3O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 1-[(E)-3-cyclobutylprop-2-enyl]-4-(cyclopropylmethoxy)-2-methyl-3-(trifluoromethoxy)benzene |
| SMILES | Cc1c(C/C=C/C2CCC2)ccc(OCC2CC2)c1OC(F)(F)F |
| InChI | InChI=1S/C19H23F3O2/c1-13-16(7-3-6-14-4-2-5-14)10-11-17(23-12-15-8-9-15)18(13)24-19(20,21)22/h3,6,10-11,14-15H,2,4-5,7-9,12H2,1H3/b6-3+ |
| InChIKey | DNHPXPBIBVHPLN-ZZXKWVIFSA-N |
| XLogP | 5.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|