C18H23F3O3 — CID 162061698
1-(cyclobutylmethoxy)-4-cyclopentyloxy-2-methyl-3-(trifluoromethoxy)benzene (PubChem CID 162061698) has the molecular formula C18H23F3O3 and a molecular weight of 344.37 g/mol. Its IUPAC name is 1-(cyclobutylmethoxy)-4-cyclopentyloxy-2-methyl-3-(trifluoromethoxy)benzene.
| Compound Name | 1-(cyclobutylmethoxy)-4-cyclopentyloxy-2-methyl-3-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 162061698 |
| Molecular Formula | C18H23F3O3 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 1-(cyclobutylmethoxy)-4-cyclopentyloxy-2-methyl-3-(trifluoromethoxy)benzene |
| SMILES | Cc1c(OCC2CCC2)ccc(OC2CCCC2)c1OC(F)(F)F |
| InChI | InChI=1S/C18H23F3O3/c1-12-15(22-11-13-5-4-6-13)9-10-16(17(12)24-18(19,20)21)23-14-7-2-3-8-14/h9-10,13-14H,2-8,11H2,1H3 |
| InChIKey | GKRYGRZBZYJTJY-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |