C18H20F4O3 — CID 148688040
1-cyclopentyloxy-4-[(E)-3-cyclopropylprop-2-enoxy]-3-fluoro-2-(trifluoromethoxy)benzene (PubChem CID 148688040) has the molecular formula C18H20F4O3 and a molecular weight of 360.35 g/mol. Its IUPAC name is 1-cyclopentyloxy-4-[(E)-3-cyclopropylprop-2-enoxy]-3-fluoro-2-(trifluoromethoxy)benzene.
| Compound Name | 1-cyclopentyloxy-4-[(E)-3-cyclopropylprop-2-enoxy]-3-fluoro-2-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 148688040 |
| Molecular Formula | C18H20F4O3 |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 1-cyclopentyloxy-4-[(E)-3-cyclopropylprop-2-enoxy]-3-fluoro-2-(trifluoromethoxy)benzene |
| SMILES | Fc1c(OC/C=C/C2CC2)ccc(OC2CCCC2)c1OC(F)(F)F |
| InChI | InChI=1S/C18H20F4O3/c19-16-14(23-11-3-4-12-7-8-12)9-10-15(17(16)25-18(20,21)22)24-13-5-1-2-6-13/h3-4,9-10,12-13H,1-2,5-8,11H2/b4-3+ |
| InChIKey | NSXAKXKTMNEFFS-ONEGZZNKSA-N |
| XLogP | 5.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|