C20H24F4O2 — CID 148649365
1-[(E)-4-cyclobutylbut-3-enyl]-4-(cyclobutylmethoxy)-2-fluoro-3-(trifluoromethoxy)benzene (PubChem CID 148649365) has the molecular formula C20H24F4O2 and a molecular weight of 372.40 g/mol. Its IUPAC name is 1-[(E)-4-cyclobutylbut-3-enyl]-4-(cyclobutylmethoxy)-2-fluoro-3-(trifluoromethoxy)benzene.
| Compound Name | 1-[(E)-4-cyclobutylbut-3-enyl]-4-(cyclobutylmethoxy)-2-fluoro-3-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 148649365 |
| Molecular Formula | C20H24F4O2 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 1-[(E)-4-cyclobutylbut-3-enyl]-4-(cyclobutylmethoxy)-2-fluoro-3-(trifluoromethoxy)benzene |
| SMILES | Fc1c(CC/C=C/C2CCC2)ccc(OCC2CCC2)c1OC(F)(F)F |
| InChI | InChI=1S/C20H24F4O2/c21-18-16(10-2-1-5-14-6-3-7-14)11-12-17(19(18)26-20(22,23)24)25-13-15-8-4-9-15/h1,5,11-12,14-15H,2-4,6-10,13H2/b5-1+ |
| InChIKey | NLPUQQVPHUOSMS-ORCRQEGFSA-N |
| XLogP | 6.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|