C19H24F4O2 — CID 153282549
1-(cyclopentylmethoxy)-4-(cyclopentylmethyl)-3-fluoro-2-(trifluoromethoxy)benzene (PubChem CID 153282549) has the molecular formula C19H24F4O2 and a molecular weight of 360.39 g/mol. Its IUPAC name is 1-(cyclopentylmethoxy)-4-(cyclopentylmethyl)-3-fluoro-2-(trifluoromethoxy)benzene.
| Compound Name | 1-(cyclopentylmethoxy)-4-(cyclopentylmethyl)-3-fluoro-2-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 153282549 |
| Molecular Formula | C19H24F4O2 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 1-(cyclopentylmethoxy)-4-(cyclopentylmethyl)-3-fluoro-2-(trifluoromethoxy)benzene |
| SMILES | Fc1c(CC2CCCC2)ccc(OCC2CCCC2)c1OC(F)(F)F |
| InChI | InChI=1S/C19H24F4O2/c20-17-15(11-13-5-1-2-6-13)9-10-16(18(17)25-19(21,22)23)24-12-14-7-3-4-8-14/h9-10,13-14H,1-8,11-12H2 |
| InChIKey | SOXRSMFQYPOCIK-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |