C17H20F4O2 — CID 153282633
1-(2-cyclobutylethoxy)-4-(cyclopropylmethyl)-3-fluoro-2-(trifluoromethoxy)benzene (PubChem CID 153282633) has the molecular formula C17H20F4O2 and a molecular weight of 332.34 g/mol. Its IUPAC name is 1-(2-cyclobutylethoxy)-4-(cyclopropylmethyl)-3-fluoro-2-(trifluoromethoxy)benzene.
| Compound Name | 1-(2-cyclobutylethoxy)-4-(cyclopropylmethyl)-3-fluoro-2-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 153282633 |
| Molecular Formula | C17H20F4O2 |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 1-(2-cyclobutylethoxy)-4-(cyclopropylmethyl)-3-fluoro-2-(trifluoromethoxy)benzene |
| SMILES | Fc1c(CC2CC2)ccc(OCCC2CCC2)c1OC(F)(F)F |
| InChI | InChI=1S/C17H20F4O2/c18-15-13(10-12-4-5-12)6-7-14(16(15)23-17(19,20)21)22-9-8-11-2-1-3-11/h6-7,11-12H,1-5,8-10H2 |
| InChIKey | COJFINRSFZAPIO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |