C21H26F4O2 — CID 148983725
1-(cyclopentylmethoxy)-4-[(E)-3-cyclopentylprop-2-enyl]-3-fluoro-2-(trifluoromethoxy)benzene (PubChem CID 148983725) has the molecular formula C21H26F4O2 and a molecular weight of 386.43 g/mol. Its IUPAC name is 1-(cyclopentylmethoxy)-4-[(E)-3-cyclopentylprop-2-enyl]-3-fluoro-2-(trifluoromethoxy)benzene.
| Compound Name | 1-(cyclopentylmethoxy)-4-[(E)-3-cyclopentylprop-2-enyl]-3-fluoro-2-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 148983725 |
| Molecular Formula | C21H26F4O2 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 1-(cyclopentylmethoxy)-4-[(E)-3-cyclopentylprop-2-enyl]-3-fluoro-2-(trifluoromethoxy)benzene |
| SMILES | Fc1c(C/C=C/C2CCCC2)ccc(OCC2CCCC2)c1OC(F)(F)F |
| InChI | InChI=1S/C21H26F4O2/c22-19-17(11-5-10-15-6-1-2-7-15)12-13-18(20(19)27-21(23,24)25)26-14-16-8-3-4-9-16/h5,10,12-13,15-16H,1-4,6-9,11,14H2/b10-5+ |
| InChIKey | PWGFVICCDWETFB-BJMVGYQFSA-N |
| XLogP | 6.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|