C19H22F4O3 — CID 153282527
1-(2-cyclobutylethoxy)-4-[(E)-3-cyclopropylprop-2-enoxy]-3-fluoro-2-(trifluoromethoxy)benzene (PubChem CID 153282527) has the molecular formula C19H22F4O3 and a molecular weight of 374.37 g/mol. Its IUPAC name is 1-(2-cyclobutylethoxy)-4-[(E)-3-cyclopropylprop-2-enoxy]-3-fluoro-2-(trifluoromethoxy)benzene.
| Compound Name | 1-(2-cyclobutylethoxy)-4-[(E)-3-cyclopropylprop-2-enoxy]-3-fluoro-2-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 153282527 |
| Molecular Formula | C19H22F4O3 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 1-(2-cyclobutylethoxy)-4-[(E)-3-cyclopropylprop-2-enoxy]-3-fluoro-2-(trifluoromethoxy)benzene |
| SMILES | Fc1c(OC/C=C/C2CC2)ccc(OCCC2CCC2)c1OC(F)(F)F |
| InChI | InChI=1S/C19H22F4O3/c20-17-15(24-11-2-5-14-6-7-14)8-9-16(18(17)26-19(21,22)23)25-12-10-13-3-1-4-13/h2,5,8-9,13-14H,1,3-4,6-7,10-12H2/b5-2+ |
| InChIKey | ZJNPHAINPWWRKN-GORDUTHDSA-N |
| XLogP | 5.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|