C18H23FO2 — CID 158095086
1-cyclobutyloxy-4-[(E)-3-cyclobutylprop-2-enoxy]-2-fluoro-3-methylbenzene (PubChem CID 158095086) has the molecular formula C18H23FO2 and a molecular weight of 290.38 g/mol. Its IUPAC name is 1-cyclobutyloxy-4-[(E)-3-cyclobutylprop-2-enoxy]-2-fluoro-3-methylbenzene.
| Compound Name | 1-cyclobutyloxy-4-[(E)-3-cyclobutylprop-2-enoxy]-2-fluoro-3-methylbenzene |
|---|---|
| PubChem CID | 158095086 |
| Molecular Formula | C18H23FO2 |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 1-cyclobutyloxy-4-[(E)-3-cyclobutylprop-2-enoxy]-2-fluoro-3-methylbenzene |
| SMILES | Cc1c(OC/C=C/C2CCC2)ccc(OC2CCC2)c1F |
| InChI | InChI=1S/C18H23FO2/c1-13-16(20-12-4-7-14-5-2-6-14)10-11-17(18(13)19)21-15-8-3-9-15/h4,7,10-11,14-15H,2-3,5-6,8-9,12H2,1H3/b7-4+ |
| InChIKey | SLQHUXNARIDIBI-QPJJXVBHSA-N |
| XLogP | 4.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|