C15H19FO — CID 162141798
1-(cyclobutylmethyl)-4-cyclopropyloxy-3-fluoro-2-methylbenzene (PubChem CID 162141798) has the molecular formula C15H19FO and a molecular weight of 234.31 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-4-cyclopropyloxy-3-fluoro-2-methylbenzene.
| Compound Name | 1-(cyclobutylmethyl)-4-cyclopropyloxy-3-fluoro-2-methylbenzene |
|---|---|
| PubChem CID | 162141798 |
| Molecular Formula | C15H19FO |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-(cyclobutylmethyl)-4-cyclopropyloxy-3-fluoro-2-methylbenzene |
| SMILES | Cc1c(CC2CCC2)ccc(OC2CC2)c1F |
| InChI | InChI=1S/C15H19FO/c1-10-12(9-11-3-2-4-11)5-8-14(15(10)16)17-13-6-7-13/h5,8,11,13H,2-4,6-7,9H2,1H3 |
| InChIKey | LMQBESKDHFJJBM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |