C22H22F4O2 — CID 67434469
1-(cyclohexylidenemethoxymethyl)-4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorobenzene (PubChem CID 67434469) has the molecular formula C22H22F4O2 and a molecular weight of 394.41 g/mol. Its IUPAC name is 1-(cyclohexylidenemethoxymethyl)-4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorobenzene.
| Compound Name | 1-(cyclohexylidenemethoxymethyl)-4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorobenzene |
|---|---|
| PubChem CID | 67434469 |
| Molecular Formula | C22H22F4O2 |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 1-(cyclohexylidenemethoxymethyl)-4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorobenzene |
| SMILES | CCOc1ccc(-c2ccc(COC=C3CCCCC3)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C22H22F4O2/c1-2-28-18-11-10-17(21(25)22(18)26)16-9-8-15(19(23)20(16)24)13-27-12-14-6-4-3-5-7-14/h8-12H,2-7,13H2,1H3 |
| InChIKey | DMWYARYIEVBOOA-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|