C21H21F5O — CID 123767664
1-[2,3-difluoro-4-(7-fluorohept-3-enyl)phenyl]-4-ethoxy-2,3-difluorobenzene (PubChem CID 123767664) has the molecular formula C21H21F5O and a molecular weight of 384.39 g/mol. Its IUPAC name is 1-[2,3-difluoro-4-(7-fluorohept-3-enyl)phenyl]-4-ethoxy-2,3-difluorobenzene.
| Compound Name | 1-[2,3-difluoro-4-(7-fluorohept-3-enyl)phenyl]-4-ethoxy-2,3-difluorobenzene |
|---|---|
| PubChem CID | 123767664 |
| Molecular Formula | C21H21F5O |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 1-[2,3-difluoro-4-(7-fluorohept-3-enyl)phenyl]-4-ethoxy-2,3-difluorobenzene |
| SMILES | CCOc1ccc(-c2ccc(CCC=CCCCF)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C21H21F5O/c1-2-27-17-12-11-16(20(25)21(17)26)15-10-9-14(18(23)19(15)24)8-6-4-3-5-7-13-22/h3-4,9-12H,2,5-8,13H2,1H3 |
| InChIKey | RNIXEKKMWPZDFM-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|