C22H23F5O2 — CID 77385910
1-[3-(2,3-difluoro-4-pent-3-enylphenoxy)-1-fluoropropyl]-4-ethoxy-2,3-difluorobenzene (PubChem CID 77385910) has the molecular formula C22H23F5O2 and a molecular weight of 414.41 g/mol. Its IUPAC name is 1-[3-(2,3-difluoro-4-pent-3-enylphenoxy)-1-fluoropropyl]-4-ethoxy-2,3-difluorobenzene.
| Compound Name | 1-[3-(2,3-difluoro-4-pent-3-enylphenoxy)-1-fluoropropyl]-4-ethoxy-2,3-difluorobenzene |
|---|---|
| PubChem CID | 77385910 |
| Molecular Formula | C22H23F5O2 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 1-[3-(2,3-difluoro-4-pent-3-enylphenoxy)-1-fluoropropyl]-4-ethoxy-2,3-difluorobenzene |
| SMILES | CC=CCCc1ccc(OCCC(F)c2ccc(OCC)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C22H23F5O2/c1-3-5-6-7-14-8-10-18(21(26)19(14)24)29-13-12-16(23)15-9-11-17(28-4-2)22(27)20(15)25/h3,5,8-11,16H,4,6-7,12-13H2,1-2H3 |
| InChIKey | MQVQMVQDCCYHPH-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|