C22H27ClF2O2 — CID 176948903
[4-[[4-(4-cyclopropylcyclohexyl)cyclohexen-1-yl]methoxy]-2,3-difluorophenyl] hypochlorite (PubChem CID 176948903) has the molecular formula C22H27ClF2O2 and a molecular weight of 396.91 g/mol. Its IUPAC name is [4-[[4-(4-cyclopropylcyclohexyl)cyclohexen-1-yl]methoxy]-2,3-difluorophenyl] hypochlorite.
| Compound Name | [4-[[4-(4-cyclopropylcyclohexyl)cyclohexen-1-yl]methoxy]-2,3-difluorophenyl] hypochlorite |
|---|---|
| PubChem CID | 176948903 |
| Molecular Formula | C22H27ClF2O2 |
| Molecular Weight | 396.91 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | [4-[[4-(4-cyclopropylcyclohexyl)cyclohexen-1-yl]methoxy]-2,3-difluorophenyl] hypochlorite |
| SMILES | Fc1c(OCl)ccc(OCC2=CCC(C3CCC(C4CC4)CC3)CC2)c1F |
| InChI | InChI=1S/C22H27ClF2O2/c23-27-20-12-11-19(21(24)22(20)25)26-13-14-1-3-15(4-2-14)16-5-7-17(8-6-16)18-9-10-18/h1,11-12,15-18H,2-10,13H2 |
| InChIKey | PLZSIXKTOIANJW-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.91 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|