C28H38F2O2 — CID 169258986
1-(cyclopentylmethoxy)-2,3-difluoro-4-[[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexen-1-yl]methoxy]benzene (PubChem CID 169258986) has the molecular formula C28H38F2O2 and a molecular weight of 444.61 g/mol. Its IUPAC name is 1-(cyclopentylmethoxy)-2,3-difluoro-4-[[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexen-1-yl]methoxy]benzene.
| Compound Name | 1-(cyclopentylmethoxy)-2,3-difluoro-4-[[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexen-1-yl]methoxy]benzene |
|---|---|
| PubChem CID | 169258986 |
| Molecular Formula | C28H38F2O2 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | 1-(cyclopentylmethoxy)-2,3-difluoro-4-[[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexen-1-yl]methoxy]benzene |
| SMILES | C/C=C/C1CCC(C2CC=C(COc3ccc(OCC4CCCC4)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C28H38F2O2/c1-2-5-20-8-12-23(13-9-20)24-14-10-22(11-15-24)19-32-26-17-16-25(27(29)28(26)30)31-18-21-6-3-4-7-21/h2,5,10,16-17,20-21,23-24H,3-4,6-9,11-15,18-19H2,1H3/b5-2+ |
| InChIKey | QEUOMKJNJYIKFC-GORDUTHDSA-N |
| XLogP | 8.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|