C20H19F5O4 — CID 88597332
[4-(4-ethoxyphenyl)-2,3-difluorophenyl] 1,1,1-trifluoropentan-2-yl carbonate (PubChem CID 88597332) has the molecular formula C20H19F5O4 and a molecular weight of 418.36 g/mol. Its IUPAC name is [4-(4-ethoxyphenyl)-2,3-difluorophenyl] 1,1,1-trifluoropentan-2-yl carbonate.
| Compound Name | [4-(4-ethoxyphenyl)-2,3-difluorophenyl] 1,1,1-trifluoropentan-2-yl carbonate |
|---|---|
| PubChem CID | 88597332 |
| Molecular Formula | C20H19F5O4 |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | [4-(4-ethoxyphenyl)-2,3-difluorophenyl] 1,1,1-trifluoropentan-2-yl carbonate |
| SMILES | CCCC(OC(=O)Oc1ccc(-c2ccc(OCC)cc2)c(F)c1F)C(F)(F)F |
| InChI | InChI=1S/C20H19F5O4/c1-3-5-16(20(23,24)25)29-19(26)28-15-11-10-14(17(21)18(15)22)12-6-8-13(9-7-12)27-4-2/h6-11,16H,3-5H2,1-2H3 |
| InChIKey | WVESSRQQDZTOMA-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|