C41H40F10O8 — CID 88597331
[4-(4-ethoxyphenyl)-2,3-difluorophenyl] 1,1,1-trifluorohexan-2-yl carbonate;[4-(4-ethoxyphenyl)-2,3-difluorophenyl] 1,1,1-trifluoropentan-2-yl carbonate (PubChem CID 88597331) has the molecular formula C41H40F10O8 and a molecular weight of 850.74 g/mol. Its IUPAC name is [4-(4-ethoxyphenyl)-2,3-difluorophenyl] 1,1,1-trifluorohexan-2-yl carbonate;[4-(4-ethoxyphenyl)-2,3-difluorophenyl] 1,1,1-trifluoropentan-2-yl carbonate.
| Compound Name | [4-(4-ethoxyphenyl)-2,3-difluorophenyl] 1,1,1-trifluorohexan-2-yl carbonate;[4-(4-ethoxyphenyl)-2,3-difluorophenyl] 1,1,1-trifluoropentan-2-yl carbonate |
|---|---|
| PubChem CID | 88597331 |
| Molecular Formula | C41H40F10O8 |
| Molecular Weight | 850.74 g/mol |
| Exact Mass | 850.26 |
| IUPAC Name | [4-(4-ethoxyphenyl)-2,3-difluorophenyl] 1,1,1-trifluorohexan-2-yl carbonate;[4-(4-ethoxyphenyl)-2,3-difluorophenyl] 1,1,1-trifluoropentan-2-yl carbonate |
| SMILES | CCCC(OC(=O)Oc1ccc(-c2ccc(OCC)cc2)c(F)c1F)C(F)(F)F.CCCCC(OC(=O)Oc1ccc(-c2ccc(OCC)cc2)c(F)c1F)C(F)(F)F |
| InChI | InChI=1S/C21H21F5O4.C20H19F5O4/c1-3-5-6-17(21(24,25)26)30-20(27)29-16-12-11-15(18(22)19(16)23)13-7-9-14(10-8-13)28-4-2;1-3-5-16(20(23,24)25)29-19(26)28-15-11-10-14(17(21)18(15)22)12-6-8-13(9-7-12)27-4-2/h7-12,17H,3-6H2,1-2H3;6-11,16H,3-5H2,1-2H3 |
| InChIKey | UNSUBOGLZUEQKW-UHFFFAOYSA-N |
| XLogP | 12.94 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.74 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|