C25H31F2NO4 — CID 134486557
[3-fluoro-4-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)phenyl] 4-ethoxy-2-fluorobenzoate (PubChem CID 134486557) has the molecular formula C25H31F2NO4 and a molecular weight of 447.52 g/mol. Its IUPAC name is [3-fluoro-4-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)phenyl] 4-ethoxy-2-fluorobenzoate.
| Compound Name | [3-fluoro-4-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)phenyl] 4-ethoxy-2-fluorobenzoate |
|---|---|
| PubChem CID | 134486557 |
| Molecular Formula | C25H31F2NO4 |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | [3-fluoro-4-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)phenyl] 4-ethoxy-2-fluorobenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc(C3CC(C)(C)N(OC)C(C)(C)C3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C25H31F2NO4/c1-7-31-17-8-11-20(22(27)12-17)23(29)32-18-9-10-19(21(26)13-18)16-14-24(2,3)28(30-6)25(4,5)15-16/h8-13,16H,7,14-15H2,1-6H3 |
| InChIKey | CGSCGEUIYXPGGA-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|