C14H17FO2 — CID 118586613
3-(4-ethoxy-2-fluorophenyl)-6-methyl-3,4-dihydro-2H-pyran (PubChem CID 118586613) has the molecular formula C14H17FO2 and a molecular weight of 236.29 g/mol. Its IUPAC name is 3-(4-ethoxy-2-fluorophenyl)-6-methyl-3,4-dihydro-2H-pyran.
| Compound Name | 3-(4-ethoxy-2-fluorophenyl)-6-methyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 118586613 |
| Molecular Formula | C14H17FO2 |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 3-(4-ethoxy-2-fluorophenyl)-6-methyl-3,4-dihydro-2H-pyran |
| SMILES | CCOc1ccc(C2CC=C(C)OC2)c(F)c1 |
| InChI | InChI=1S/C14H17FO2/c1-3-16-12-6-7-13(14(15)8-12)11-5-4-10(2)17-9-11/h4,6-8,11H,3,5,9H2,1-2H3 |
| InChIKey | JIXALJWFPNGTTR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |