C15H19FO3 — CID 171955161
3-(4-ethoxy-2-fluorophenyl)-8-oxabicyclo[3.2.1]octan-3-ol (PubChem CID 171955161) has the molecular formula C15H19FO3 and a molecular weight of 266.31 g/mol. Its IUPAC name is 3-(4-ethoxy-2-fluorophenyl)-8-oxabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-(4-ethoxy-2-fluorophenyl)-8-oxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171955161 |
| Molecular Formula | C15H19FO3 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 3-(4-ethoxy-2-fluorophenyl)-8-oxabicyclo[3.2.1]octan-3-ol |
| SMILES | CCOc1ccc(C2(O)CC3CCC(C2)O3)c(F)c1 |
| InChI | InChI=1S/C15H19FO3/c1-2-18-10-5-6-13(14(16)7-10)15(17)8-11-3-4-12(9-15)19-11/h5-7,11-12,17H,2-4,8-9H2,1H3 |
| InChIKey | YRIMLMPZZKOZTB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |