C14H16F2O3 — CID 171954665
3-(2,3-difluoro-4-methoxyphenyl)-8-oxabicyclo[3.2.1]octan-3-ol (PubChem CID 171954665) has the molecular formula C14H16F2O3 and a molecular weight of 270.27 g/mol. Its IUPAC name is 3-(2,3-difluoro-4-methoxyphenyl)-8-oxabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-(2,3-difluoro-4-methoxyphenyl)-8-oxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171954665 |
| Molecular Formula | C14H16F2O3 |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 3-(2,3-difluoro-4-methoxyphenyl)-8-oxabicyclo[3.2.1]octan-3-ol |
| SMILES | COc1ccc(C2(O)CC3CCC(C2)O3)c(F)c1F |
| InChI | InChI=1S/C14H16F2O3/c1-18-11-5-4-10(12(15)13(11)16)14(17)6-8-2-3-9(7-14)19-8/h4-5,8-9,17H,2-3,6-7H2,1H3 |
| InChIKey | JUEGNACDJHHLQV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |