C14H14F4O3 — CID 171956807
3-[2-fluoro-5-(trifluoromethoxy)phenyl]-8-oxabicyclo[3.2.1]octan-3-ol (PubChem CID 171956807) has the molecular formula C14H14F4O3 and a molecular weight of 306.25 g/mol. Its IUPAC name is 3-[2-fluoro-5-(trifluoromethoxy)phenyl]-8-oxabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-[2-fluoro-5-(trifluoromethoxy)phenyl]-8-oxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171956807 |
| Molecular Formula | C14H14F4O3 |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 3-[2-fluoro-5-(trifluoromethoxy)phenyl]-8-oxabicyclo[3.2.1]octan-3-ol |
| SMILES | OC1(c2cc(OC(F)(F)F)ccc2F)CC2CCC(C1)O2 |
| InChI | InChI=1S/C14H14F4O3/c15-12-4-3-8(21-14(16,17)18)5-11(12)13(19)6-9-1-2-10(7-13)20-9/h3-5,9-10,19H,1-2,6-7H2 |
| InChIKey | QIEOGPUJVSYPRV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |