C15H17F3O3 — CID 171956932
3-[3-methoxy-5-(trifluoromethyl)phenyl]-8-oxabicyclo[3.2.1]octan-3-ol (PubChem CID 171956932) has the molecular formula C15H17F3O3 and a molecular weight of 302.29 g/mol. Its IUPAC name is 3-[3-methoxy-5-(trifluoromethyl)phenyl]-8-oxabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-[3-methoxy-5-(trifluoromethyl)phenyl]-8-oxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171956932 |
| Molecular Formula | C15H17F3O3 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 3-[3-methoxy-5-(trifluoromethyl)phenyl]-8-oxabicyclo[3.2.1]octan-3-ol |
| SMILES | COc1cc(C(F)(F)F)cc(C2(O)CC3CCC(C2)O3)c1 |
| InChI | InChI=1S/C15H17F3O3/c1-20-13-5-9(4-10(6-13)15(16,17)18)14(19)7-11-2-3-12(8-14)21-11/h4-6,11-12,19H,2-3,7-8H2,1H3 |
| InChIKey | CCZHQIHROSPJDJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |