C15H14F3NO2 — CID 171956682
3-(3-hydroxy-8-oxabicyclo[3.2.1]octan-3-yl)-5-(trifluoromethyl)benzonitrile (PubChem CID 171956682) has the molecular formula C15H14F3NO2 and a molecular weight of 297.28 g/mol. Its IUPAC name is 3-(3-hydroxy-8-oxabicyclo[3.2.1]octan-3-yl)-5-(trifluoromethyl)benzonitrile.
| Compound Name | 3-(3-hydroxy-8-oxabicyclo[3.2.1]octan-3-yl)-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 171956682 |
| Molecular Formula | C15H14F3NO2 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 3-(3-hydroxy-8-oxabicyclo[3.2.1]octan-3-yl)-5-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1cc(C(F)(F)F)cc(C2(O)CC3CCC(C2)O3)c1 |
| InChI | InChI=1S/C15H14F3NO2/c16-15(17,18)11-4-9(8-19)3-10(5-11)14(20)6-12-1-2-13(7-14)21-12/h3-5,12-13,20H,1-2,6-7H2 |
| InChIKey | WRMJFVIAZOIURL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |