C18H21ClFIO — CID 163721502
3-chloro-2-fluoro-4-[4-(4-iodocyclohexyl)cyclohexen-1-yl]phenol (PubChem CID 163721502) has the molecular formula C18H21ClFIO and a molecular weight of 434.72 g/mol. Its IUPAC name is 3-chloro-2-fluoro-4-[4-(4-iodocyclohexyl)cyclohexen-1-yl]phenol.
| Compound Name | 3-chloro-2-fluoro-4-[4-(4-iodocyclohexyl)cyclohexen-1-yl]phenol |
|---|---|
| PubChem CID | 163721502 |
| Molecular Formula | C18H21ClFIO |
| Molecular Weight | 434.72 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | 3-chloro-2-fluoro-4-[4-(4-iodocyclohexyl)cyclohexen-1-yl]phenol |
| SMILES | Oc1ccc(C2=CCC(C3CCC(I)CC3)CC2)c(Cl)c1F |
| InChI | InChI=1S/C18H21ClFIO/c19-17-15(9-10-16(22)18(17)20)13-3-1-11(2-4-13)12-5-7-14(21)8-6-12/h3,9-12,14,22H,1-2,4-8H2 |
| InChIKey | KRZRQKANGPWBSO-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.72 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|