C12H11ClFIO — CID 163262129
3-chloro-2-fluoro-4-(4-iodocyclohexen-1-yl)phenol (PubChem CID 163262129) has the molecular formula C12H11ClFIO and a molecular weight of 352.57 g/mol. Its IUPAC name is 3-chloro-2-fluoro-4-(4-iodocyclohexen-1-yl)phenol.
| Compound Name | 3-chloro-2-fluoro-4-(4-iodocyclohexen-1-yl)phenol |
|---|---|
| PubChem CID | 163262129 |
| Molecular Formula | C12H11ClFIO |
| Molecular Weight | 352.57 g/mol |
| Exact Mass | 351.95 |
| IUPAC Name | 3-chloro-2-fluoro-4-(4-iodocyclohexen-1-yl)phenol |
| SMILES | Oc1ccc(C2=CCC(I)CC2)c(Cl)c1F |
| InChI | InChI=1S/C12H11ClFIO/c13-11-9(5-6-10(16)12(11)14)7-1-3-8(15)4-2-7/h1,5-6,8,16H,2-4H2 |
| InChIKey | DAVIMDNEPKBEKQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|