C21H28ClFO — CID 70895585
3-chloro-2-fluoro-1-methyl-4-[4-[(4-methylcyclohexyl)methoxy]cyclohexen-1-yl]benzene (PubChem CID 70895585) has the molecular formula C21H28ClFO and a molecular weight of 350.91 g/mol. Its IUPAC name is 3-chloro-2-fluoro-1-methyl-4-[4-[(4-methylcyclohexyl)methoxy]cyclohexen-1-yl]benzene.
| Compound Name | 3-chloro-2-fluoro-1-methyl-4-[4-[(4-methylcyclohexyl)methoxy]cyclohexen-1-yl]benzene |
|---|---|
| PubChem CID | 70895585 |
| Molecular Formula | C21H28ClFO |
| Molecular Weight | 350.91 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 3-chloro-2-fluoro-1-methyl-4-[4-[(4-methylcyclohexyl)methoxy]cyclohexen-1-yl]benzene |
| SMILES | Cc1ccc(C2=CCC(OCC3CCC(C)CC3)CC2)c(Cl)c1F |
| InChI | InChI=1S/C21H28ClFO/c1-14-3-6-16(7-4-14)13-24-18-10-8-17(9-11-18)19-12-5-15(2)21(23)20(19)22/h5,8,12,14,16,18H,3-4,6-7,9-11,13H2,1-2H3 |
| InChIKey | KEBIDKMUKKVYEC-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.91 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |