C36H46F4O2 — CID 67967592
2-[4-[[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenoxy]methyl]cyclohexyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 67967592) has the molecular formula C36H46F4O2 and a molecular weight of 586.75 g/mol. Its IUPAC name is 2-[4-[[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenoxy]methyl]cyclohexyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[4-[[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenoxy]methyl]cyclohexyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 67967592 |
| Molecular Formula | C36H46F4O2 |
| Molecular Weight | 586.75 g/mol |
| Exact Mass | 586.34 |
| IUPAC Name | 2-[4-[[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenoxy]methyl]cyclohexyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C/C=C/CCC1CCC2CC(C3CCC(COc4ccc(-c5ccc(OCC)c(F)c5F)c(F)c4F)CC3)CCC2C1 |
| InChI | InChI=1S/C36H46F4O2/c1-3-5-6-7-23-8-13-28-21-27(15-14-26(28)20-23)25-11-9-24(10-12-25)22-42-32-19-17-30(34(38)36(32)40)29-16-18-31(41-4-2)35(39)33(29)37/h3,5,16-19,23-28H,4,6-15,20-22H2,1-2H3/b5-3+ |
| InChIKey | LGNHMTQNDMFHKJ-HWKANZROSA-N |
| XLogP | 10.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.75 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|