C23H32ClFO — CID 143286528
3-chloro-1-ethoxy-2-fluoro-4-[(E)-2-[4-(4-methylcyclohexyl)cyclohexyl]ethenyl]benzene (PubChem CID 143286528) has the molecular formula C23H32ClFO and a molecular weight of 378.96 g/mol. Its IUPAC name is 3-chloro-1-ethoxy-2-fluoro-4-[(E)-2-[4-(4-methylcyclohexyl)cyclohexyl]ethenyl]benzene.
| Compound Name | 3-chloro-1-ethoxy-2-fluoro-4-[(E)-2-[4-(4-methylcyclohexyl)cyclohexyl]ethenyl]benzene |
|---|---|
| PubChem CID | 143286528 |
| Molecular Formula | C23H32ClFO |
| Molecular Weight | 378.96 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 3-chloro-1-ethoxy-2-fluoro-4-[(E)-2-[4-(4-methylcyclohexyl)cyclohexyl]ethenyl]benzene |
| SMILES | CCOc1ccc(/C=C/C2CCC(C3CCC(C)CC3)CC2)c(Cl)c1F |
| InChI | InChI=1S/C23H32ClFO/c1-3-26-21-15-14-20(22(24)23(21)25)13-8-17-6-11-19(12-7-17)18-9-4-16(2)5-10-18/h8,13-19H,3-7,9-12H2,1-2H3/b13-8+ |
| InChIKey | YGUDLKGYNMINPO-MDWZMJQESA-N |
| XLogP | 7.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.96 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |