C22H30F2O — CID 123364242
1-[[4-(4-ethenylcyclohexyl)cyclohexyl]methyl]-2,3-difluoro-4-methoxybenzene (PubChem CID 123364242) has the molecular formula C22H30F2O and a molecular weight of 348.48 g/mol. Its IUPAC name is 1-[[4-(4-ethenylcyclohexyl)cyclohexyl]methyl]-2,3-difluoro-4-methoxybenzene.
| Compound Name | 1-[[4-(4-ethenylcyclohexyl)cyclohexyl]methyl]-2,3-difluoro-4-methoxybenzene |
|---|---|
| PubChem CID | 123364242 |
| Molecular Formula | C22H30F2O |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 1-[[4-(4-ethenylcyclohexyl)cyclohexyl]methyl]-2,3-difluoro-4-methoxybenzene |
| SMILES | C=CC1CCC(C2CCC(Cc3ccc(OC)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C22H30F2O/c1-3-15-4-8-17(9-5-15)18-10-6-16(7-11-18)14-19-12-13-20(25-2)22(24)21(19)23/h3,12-13,15-18H,1,4-11,14H2,2H3 |
| InChIKey | VMLCAJKNUILACS-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|