C21H17F5O — CID 170360093
1-[4-(4-ethenylcyclohexen-1-yl)phenyl]-2,4-difluoro-3-(trifluoromethoxy)benzene (PubChem CID 170360093) has the molecular formula C21H17F5O and a molecular weight of 380.36 g/mol. Its IUPAC name is 1-[4-(4-ethenylcyclohexen-1-yl)phenyl]-2,4-difluoro-3-(trifluoromethoxy)benzene.
| Compound Name | 1-[4-(4-ethenylcyclohexen-1-yl)phenyl]-2,4-difluoro-3-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 170360093 |
| Molecular Formula | C21H17F5O |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 1-[4-(4-ethenylcyclohexen-1-yl)phenyl]-2,4-difluoro-3-(trifluoromethoxy)benzene |
| SMILES | C=CC1CC=C(c2ccc(-c3ccc(F)c(OC(F)(F)F)c3F)cc2)CC1 |
| InChI | InChI=1S/C21H17F5O/c1-2-13-3-5-14(6-4-13)15-7-9-16(10-8-15)17-11-12-18(22)20(19(17)23)27-21(24,25)26/h2,5,7-13H,1,3-4,6H2 |
| InChIKey | PLDJYWFEYCBNBJ-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|