C25H32ClF — CID 89022910
3-chloro-1-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-2-fluoro-4-[(E)-pent-3-enyl]benzene (PubChem CID 89022910) has the molecular formula C25H32ClF and a molecular weight of 386.98 g/mol. Its IUPAC name is 3-chloro-1-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-2-fluoro-4-[(E)-pent-3-enyl]benzene.
| Compound Name | 3-chloro-1-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-2-fluoro-4-[(E)-pent-3-enyl]benzene |
|---|---|
| PubChem CID | 89022910 |
| Molecular Formula | C25H32ClF |
| Molecular Weight | 386.98 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 3-chloro-1-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-2-fluoro-4-[(E)-pent-3-enyl]benzene |
| SMILES | C=CC1CCC(C2CC=C(c3ccc(CC/C=C/C)c(Cl)c3F)CC2)CC1 |
| InChI | InChI=1S/C25H32ClF/c1-3-5-6-7-22-16-17-23(25(27)24(22)26)21-14-12-20(13-15-21)19-10-8-18(4-2)9-11-19/h3-5,14,16-20H,2,6-13,15H2,1H3/b5-3+ |
| InChIKey | TZOOOYIYLDZTBX-HWKANZROSA-N |
| XLogP | 8.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.98 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|