C24H37F3O — CID 171812501
2-[4-[4-(cyclobutylmethyl)cyclohexyl]cyclohexen-1-yl]-5-(trifluoromethyl)cyclohexan-1-ol (PubChem CID 171812501) has the molecular formula C24H37F3O and a molecular weight of 398.55 g/mol. Its IUPAC name is 2-[4-[4-(cyclobutylmethyl)cyclohexyl]cyclohexen-1-yl]-5-(trifluoromethyl)cyclohexan-1-ol.
| Compound Name | 2-[4-[4-(cyclobutylmethyl)cyclohexyl]cyclohexen-1-yl]-5-(trifluoromethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 171812501 |
| Molecular Formula | C24H37F3O |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | 2-[4-[4-(cyclobutylmethyl)cyclohexyl]cyclohexen-1-yl]-5-(trifluoromethyl)cyclohexan-1-ol |
| SMILES | OC1CC(C(F)(F)F)CCC1C1=CCC(C2CCC(CC3CCC3)CC2)CC1 |
| InChI | InChI=1S/C24H37F3O/c25-24(26,27)21-12-13-22(23(28)15-21)20-10-8-19(9-11-20)18-6-4-17(5-7-18)14-16-2-1-3-16/h10,16-19,21-23,28H,1-9,11-15H2 |
| InChIKey | ROSTWVKDMHDAKR-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|