C21H34O2Y — CID 177321429
2-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-5-methoxycyclohexan-1-ol;yttrium (PubChem CID 177321429) has the molecular formula C21H34O2Y and a molecular weight of 407.41 g/mol. Its IUPAC name is 2-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-5-methoxycyclohexan-1-ol;yttrium.
| Compound Name | 2-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-5-methoxycyclohexan-1-ol;yttrium |
|---|---|
| PubChem CID | 177321429 |
| Molecular Formula | C21H34O2Y |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 2-[4-(4-ethenylcyclohexyl)cyclohexen-1-yl]-5-methoxycyclohexan-1-ol;yttrium |
| SMILES | C=CC1CCC(C2CC=C(C3CCC(OC)CC3O)CC2)CC1.[Y] |
| InChI | InChI=1S/C21H34O2.Y/c1-3-15-4-6-16(7-5-15)17-8-10-18(11-9-17)20-13-12-19(23-2)14-21(20)22;/h3,10,15-17,19-22H,1,4-9,11-14H2,2H3; |
| InChIKey | CCRQBQCGYTVZSH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|