C25H40O2 — CID 163080633
(3S,6S,8S,11S,12S,15R,16S,19S,21R)-8,19-dimethoxypentacyclo[13.8.0.03,12.06,11.016,21]tricos-1(23)-ene (PubChem CID 163080633) has the molecular formula C25H40O2 and a molecular weight of 372.59 g/mol. Its IUPAC name is (3S,6S,8S,11S,12S,15R,16S,19S,21R)-8,19-dimethoxypentacyclo[13.8.0.03,12.06,11.016,21]tricos-1(23)-ene.
| Compound Name | (3S,6S,8S,11S,12S,15R,16S,19S,21R)-8,19-dimethoxypentacyclo[13.8.0.03,12.06,11.016,21]tricos-1(23)-ene |
|---|---|
| PubChem CID | 163080633 |
| Molecular Formula | C25H40O2 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | (3S,6S,8S,11S,12S,15R,16S,19S,21R)-8,19-dimethoxypentacyclo[13.8.0.03,12.06,11.016,21]tricos-1(23)-ene |
| SMILES | CO[C@H]1CC[C@H]2[C@@H](CC[C@H]3CC4=CC[C@@H]5C[C@@H](OC)CC[C@@H]5[C@H]4CC[C@@H]32)C1 |
| InChI | InChI=1S/C25H40O2/c1-26-20-7-9-22-18(14-20)5-3-16-13-17-4-6-19-15-21(27-2)8-10-23(19)25(17)12-11-24(16)22/h3,17-25H,4-15H2,1-2H3/t17-,18+,19-,20-,21-,22-,23-,24-,25-/m0/s1 |
| InChIKey | SRLQTLATHMPQSG-PSZPQWBSSA-N |
| XLogP | 6.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|