C18H22 — CID 165026103
2-[(1E,3Z,5Z,7Z,9Z)-cycloundeca-1,3,5,7,9-pentaen-1-yl]bicyclo[3.2.0]heptane (PubChem CID 165026103) has the molecular formula C18H22 and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-[(1E,3Z,5Z,7Z,9Z)-cycloundeca-1,3,5,7,9-pentaen-1-yl]bicyclo[3.2.0]heptane.
| Compound Name | 2-[(1E,3Z,5Z,7Z,9Z)-cycloundeca-1,3,5,7,9-pentaen-1-yl]bicyclo[3.2.0]heptane |
|---|---|
| PubChem CID | 165026103 |
| Molecular Formula | C18H22 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 2-[(1E,3Z,5Z,7Z,9Z)-cycloundeca-1,3,5,7,9-pentaen-1-yl]bicyclo[3.2.0]heptane |
| SMILES | C1=C\C=C/C=C(/C2CCC3CCC32)C/C=C\C=C/1 |
| InChI | InChI=1S/C18H22/c1-2-4-6-8-10-15(9-7-5-3-1)17-13-11-16-12-14-18(16)17/h1-9,16-18H,10-14H2/b3-1-,4-2-,7-5-,8-6-,15-9+ |
| InChIKey | LXGFIVCPDDGMMD-VRBSJLRHSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |