C11H14 — CID 163850420
3-cyclopenta-1,3-dien-1-ylbicyclo[3.1.0]hexane (PubChem CID 163850420) has the molecular formula C11H14 and a molecular weight of 146.23 g/mol. Its IUPAC name is 3-cyclopenta-1,3-dien-1-ylbicyclo[3.1.0]hexane.
| Compound Name | 3-cyclopenta-1,3-dien-1-ylbicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 163850420 |
| Molecular Formula | C11H14 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 3-cyclopenta-1,3-dien-1-ylbicyclo[3.1.0]hexane |
| SMILES | C1=CCC(C2CC3CC3C2)=C1 |
| InChI | InChI=1S/C11H14/c1-2-4-8(3-1)9-5-10-7-11(10)6-9/h1-3,9-11H,4-7H2 |
| InChIKey | OTWYGXIHPQSGLJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |