C19H32O3 — CID 141341927
[(8R,9R,10S,13R,14S)-3-methoxy-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-13-yl]methanediol (PubChem CID 141341927) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is [(8R,9R,10S,13R,14S)-3-methoxy-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-13-yl]methanediol.
| Compound Name | [(8R,9R,10S,13R,14S)-3-methoxy-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-13-yl]methanediol |
|---|---|
| PubChem CID | 141341927 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | [(8R,9R,10S,13R,14S)-3-methoxy-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-13-yl]methanediol |
| SMILES | COC1CC[C@H]2C(CC[C@@H]3[C@@H]2CC[C@]2(C(O)O)CCC[C@@H]32)C1 |
| InChI | InChI=1S/C19H32O3/c1-22-13-5-7-14-12(11-13)4-6-16-15(14)8-10-19(18(20)21)9-2-3-17(16)19/h12-18,20-21H,2-11H2,1H3/t12?,13?,14-,15+,16+,17-,19+/m0/s1 |
| InChIKey | MYESBUSBHNODRO-DWNMYBFWSA-N |
| XLogP | 3.33 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|