C14H26O3 — CID 118147016
(2S)-2-(6-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)propane-1,1-diol (PubChem CID 118147016) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is (2S)-2-(6-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)propane-1,1-diol.
| Compound Name | (2S)-2-(6-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)propane-1,1-diol |
|---|---|
| PubChem CID | 118147016 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | (2S)-2-(6-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)propane-1,1-diol |
| SMILES | COC1CCC2CC([C@H](C)C(O)O)CCC2C1 |
| InChI | InChI=1S/C14H26O3/c1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10/h9-16H,3-8H2,1-2H3/t9-,10?,11?,12?,13?/m0/s1 |
| InChIKey | RUFTYRLLJDJATD-TWJXAIAZSA-N |
| XLogP | 2.16 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|