C14H26NO3- — CID 163498103
N-[(7-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)oxy]-N-oxidopropan-2-amine (PubChem CID 163498103) has the molecular formula C14H26NO3- and a molecular weight of 256.37 g/mol. Its IUPAC name is N-[(7-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)oxy]-N-oxidopropan-2-amine.
| Compound Name | N-[(7-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)oxy]-N-oxidopropan-2-amine |
|---|---|
| PubChem CID | 163498103 |
| Molecular Formula | C14H26NO3- |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | N-[(7-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)oxy]-N-oxidopropan-2-amine |
| SMILES | COC1CCC2CCC(ON([O-])C(C)C)CC2C1 |
| InChI | InChI=1S/C14H26NO3/c1-10(2)15(16)18-14-7-5-11-4-6-13(17-3)8-12(11)9-14/h10-14H,4-9H2,1-3H3/q-1 |
| InChIKey | IXBQGFDITAIJGQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|