C9H18O3 — CID 547386
1,2,4-trimethoxycyclohexane (PubChem CID 547386) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is 1,2,4-trimethoxycyclohexane.
| Compound Name | 1,2,4-trimethoxycyclohexane |
|---|---|
| PubChem CID | 547386 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | 1,2,4-trimethoxycyclohexane |
| SMILES | COC1CCC(OC)C(OC)C1 |
| InChI | InChI=1S/C9H18O3/c1-10-7-4-5-8(11-2)9(6-7)12-3/h7-9H,4-6H2,1-3H3 |
| InChIKey | SMRKOTXCQLUYSW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |