About 1-tert-butyl-2,4-dimethoxycyclohexane
1-tert-butyl-2,4-dimethoxycyclohexane (PubChem CID 140726408) has the molecular formula C12H24O2
and a molecular weight of 200.32 g/mol. Its IUPAC name is 1-tert-butyl-2,4-dimethoxycyclohexane.
Molecular Properties
| Compound Name | 1-tert-butyl-2,4-dimethoxycyclohexane |
| PubChem CID | 140726408 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 1-tert-butyl-2,4-dimethoxycyclohexane |
| SMILES | COC1CCC(C(C)(C)C)C(OC)C1 |
| InChI | InChI=1S/C12H24O2/c1-12(2,3)10-7-6-9(13-4)8-11(10)14-5/h9-11H,6-8H2,1-5H3 |
| InChIKey | PNXVBJNENXWYQC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-2,4-dimethoxycyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-2,4-dimethoxycyclohexane?
The IUPAC name of 1-tert-butyl-2,4-dimethoxycyclohexane (CID 140726408) is 1-tert-butyl-2,4-dimethoxycyclohexane.
What is the SMILES notation for 1-tert-butyl-2,4-dimethoxycyclohexane?
The canonical SMILES for 1-tert-butyl-2,4-dimethoxycyclohexane is COC1CCC(C(C)(C)C)C(OC)C1.
What is the InChIKey of 1-tert-butyl-2,4-dimethoxycyclohexane?
The InChIKey is PNXVBJNENXWYQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2/c1-12(2,3)10-7-6-9(13-4)8-11(10)14-5/h9-11H,6-8H2,1-5H3.
What are the key properties of 1-tert-butyl-2,4-dimethoxycyclohexane?
1-tert-butyl-2,4-dimethoxycyclohexane has a molecular weight of 200.32 g/mol, XLogP of 2.86, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-2,4-dimethoxycyclohexane is sourced from PubChem (CID 140726408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).