C18H30O2 — CID 56979425
[(8S,9R,10S,13R,14S)-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1H-cyclopenta[a]phenanthren-3-yl]methanediol (PubChem CID 56979425) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is [(8S,9R,10S,13R,14S)-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1H-cyclopenta[a]phenanthren-3-yl]methanediol.
| Compound Name | [(8S,9R,10S,13R,14S)-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1H-cyclopenta[a]phenanthren-3-yl]methanediol |
|---|---|
| PubChem CID | 56979425 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | [(8S,9R,10S,13R,14S)-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1H-cyclopenta[a]phenanthren-3-yl]methanediol |
| SMILES | OC(O)C1CC[C@H]2C(CC[C@H]3[C@H]4CCC[C@@H]4CC[C@@H]32)C1 |
| InChI | InChI=1S/C18H30O2/c19-18(20)13-6-7-15-12(10-13)5-9-16-14-3-1-2-11(14)4-8-17(15)16/h11-20H,1-10H2/t11-,12?,13?,14+,15+,16+,17-/m1/s1 |
| InChIKey | VTWPZCXFMUVVJZ-NLEPXCTCSA-N |
| XLogP | 3.57 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|