C20H33NO2 — CID 140607692
2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1H-cyclopenta[a]phenanthren-3-yl 2-aminopropanoate (PubChem CID 140607692) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is 2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1H-cyclopenta[a]phenanthren-3-yl 2-aminopropanoate.
| Compound Name | 2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1H-cyclopenta[a]phenanthren-3-yl 2-aminopropanoate |
|---|---|
| PubChem CID | 140607692 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | 2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1H-cyclopenta[a]phenanthren-3-yl 2-aminopropanoate |
| SMILES | CC(N)C(=O)OC1CCC2C(CCC3C4CCCC4CCC23)C1 |
| InChI | InChI=1S/C20H33NO2/c1-12(21)20(22)23-15-7-10-17-14(11-15)6-9-18-16-4-2-3-13(16)5-8-19(17)18/h12-19H,2-11,21H2,1H3 |
| InChIKey | ZMVYFFDISTWBCU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |